C17H21F6N2O4P — CID 56649855
2-(3-methylimidazol-3-ium-1-yl)ethyl 4-[(1R)-1-hydroxy-3-oxobutyl]benzoate hexafluorophosphate (PubChem CID 56649855) has the molecular formula C17H21F6N2O4P and a molecular weight of 462.33 g/mol. Its IUPAC name is 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-[(1R)-1-hydroxy-3-oxobutyl]benzoate hexafluorophosphate.
| Compound Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-[(1R)-1-hydroxy-3-oxobutyl]benzoate hexafluorophosphate |
|---|---|
| PubChem CID | 56649855 |
| Molecular Formula | C17H21F6N2O4P |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-[(1R)-1-hydroxy-3-oxobutyl]benzoate hexafluorophosphate |
| SMILES | CC(=O)C[C@@H](O)c1ccc(C(=O)OCCn2cc[n+](C)c2)cc1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C17H21N2O4.F6P/c1-13(20)11-16(21)14-3-5-15(6-4-14)17(22)23-10-9-19-8-7-18(2)12-19;1-7(2,3,4,5)6/h3-8,12,16,21H,9-11H2,1-2H3;/q+1;-1/t16-;/m1./s1 |
| InChIKey | YBQGBGIYSAKZQL-PKLMIRHRSA-N |
| XLogP | 4.56 |
| TPSA | 72.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|