C18H25N4O2+ — CID 54578968
2-(3-methylimidazol-3-ium-1-yl)ethyl 3-amino-4-(cyclopentylamino)benzoate (PubChem CID 54578968) has the molecular formula C18H25N4O2+ and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-(3-methylimidazol-3-ium-1-yl)ethyl 3-amino-4-(cyclopentylamino)benzoate.
| Compound Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl 3-amino-4-(cyclopentylamino)benzoate |
|---|---|
| PubChem CID | 54578968 |
| Molecular Formula | C18H25N4O2+ |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl 3-amino-4-(cyclopentylamino)benzoate |
| SMILES | C[n+]1ccn(CCOC(=O)c2ccc(NC3CCCC3)c(N)c2)c1 |
| InChI | InChI=1S/C18H24N4O2/c1-21-8-9-22(13-21)10-11-24-18(23)14-6-7-17(16(19)12-14)20-15-4-2-3-5-15/h6-9,12-13,15H,2-5,10-11,19H2,1H3/p+1 |
| InChIKey | RUXZXRXMNRPKJJ-UHFFFAOYSA-O |
| XLogP | 2.11 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|