C18H23BF4N4O4 — CID 54578965
2-(3-methylimidazol-3-ium-1-yl)ethyl 4-(cyclopentylamino)-3-nitrobenzoate tetrafluoroborate (PubChem CID 54578965) has the molecular formula C18H23BF4N4O4 and a molecular weight of 446.21 g/mol. Its IUPAC name is 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-(cyclopentylamino)-3-nitrobenzoate tetrafluoroborate.
| Compound Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-(cyclopentylamino)-3-nitrobenzoate tetrafluoroborate |
|---|---|
| PubChem CID | 54578965 |
| Molecular Formula | C18H23BF4N4O4 |
| Molecular Weight | 446.21 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-(cyclopentylamino)-3-nitrobenzoate tetrafluoroborate |
| SMILES | C[n+]1ccn(CCOC(=O)c2ccc(NC3CCCC3)c([N+](=O)[O-])c2)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C18H22N4O4.BF4/c1-20-8-9-21(13-20)10-11-26-18(23)14-6-7-16(17(12-14)22(24)25)19-15-4-2-3-5-15;2-1(3,4)5/h6-9,12-13,15H,2-5,10-11H2,1H3;/q;-1/p+1 |
| InChIKey | FGHUVEXMJNKAPA-UHFFFAOYSA-O |
| XLogP | 3.73 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.21 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|