C15H23N3O4 — CID 155709066
ethane;ethyl 3-nitro-4-(pyrrolidin-3-ylamino)benzoate (PubChem CID 155709066) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is ethane;ethyl 3-nitro-4-(pyrrolidin-3-ylamino)benzoate.
| Compound Name | ethane;ethyl 3-nitro-4-(pyrrolidin-3-ylamino)benzoate |
|---|---|
| PubChem CID | 155709066 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | ethane;ethyl 3-nitro-4-(pyrrolidin-3-ylamino)benzoate |
| SMILES | CC.CCOC(=O)c1ccc(NC2CCNC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H17N3O4.C2H6/c1-2-20-13(17)9-3-4-11(12(7-9)16(18)19)15-10-5-6-14-8-10;1-2/h3-4,7,10,14-15H,2,5-6,8H2,1H3;1-2H3 |
| InChIKey | LCNZNXXYPYZTEP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|