C24H35BrN2O5 — CID 87639035
dimethyl 5-[10-(3-methylimidazol-3-ium-1-yl)decoxy]benzene-1,3-dicarboxylate bromide (PubChem CID 87639035) has the molecular formula C24H35BrN2O5 and a molecular weight of 511.46 g/mol. Its IUPAC name is dimethyl 5-[10-(3-methylimidazol-3-ium-1-yl)decoxy]benzene-1,3-dicarboxylate bromide.
| Compound Name | dimethyl 5-[10-(3-methylimidazol-3-ium-1-yl)decoxy]benzene-1,3-dicarboxylate bromide |
|---|---|
| PubChem CID | 87639035 |
| Molecular Formula | C24H35BrN2O5 |
| Molecular Weight | 511.46 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | dimethyl 5-[10-(3-methylimidazol-3-ium-1-yl)decoxy]benzene-1,3-dicarboxylate bromide |
| SMILES | COC(=O)c1cc(OCCCCCCCCCCn2cc[n+](C)c2)cc(C(=O)OC)c1.[Br-] |
| InChI | InChI=1S/C24H35N2O5.BrH/c1-25-13-14-26(19-25)12-10-8-6-4-5-7-9-11-15-31-22-17-20(23(27)29-2)16-21(18-22)24(28)30-3;/h13-14,16-19H,4-12,15H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | ZQIDSUJOLMWWIM-UHFFFAOYSA-M |
| XLogP | 1.09 |
| TPSA | 70.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.46 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|