About 2-dodecoxy-2-oxoacetate;1-dodecyl-3-methylimidazol-3-ium
2-dodecoxy-2-oxoacetate;1-dodecyl-3-methylimidazol-3-ium (PubChem CID 90091614) has the molecular formula C30H56N2O4
and a molecular weight of 508.79 g/mol. Its IUPAC name is 2-dodecoxy-2-oxoacetate;1-dodecyl-3-methylimidazol-3-ium.
Molecular Properties
| Compound Name | 2-dodecoxy-2-oxoacetate;1-dodecyl-3-methylimidazol-3-ium |
| PubChem CID | 90091614 |
| Molecular Formula | C30H56N2O4 |
| Molecular Weight | 508.79 g/mol |
| Exact Mass | 508.42 |
| IUPAC Name | 2-dodecoxy-2-oxoacetate;1-dodecyl-3-methylimidazol-3-ium |
| SMILES | CCCCCCCCCCCCOC(=O)C(=O)[O-].CCCCCCCCCCCCn1cc[n+](C)c1 |
| InChI | InChI=1S/C16H31N2.C14H26O4/c1-3-4-5-6-7-8-9-10-11-12-13-18-15-14-17(2)16-18;1-2-3-4-5-6-7-8-9-10-11-12-18-14(17)13(15)16/h14-16H,3-13H2,1-2H3;2-12H2,1H3,(H,15,16)/q+1;/p-1 |
| InChIKey | OGDVPFGJTXNFJB-UHFFFAOYSA-M |
| XLogP | 6.43 |
| TPSA | 75.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.79 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-dodecoxy-2-oxoacetate;1-dodecyl-3-methylimidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dodecoxy-2-oxoacetate;1-dodecyl-3-methylimidazol-3-ium?
The IUPAC name of 2-dodecoxy-2-oxoacetate;1-dodecyl-3-methylimidazol-3-ium (CID 90091614) is 2-dodecoxy-2-oxoacetate;1-dodecyl-3-methylimidazol-3-ium.
What is the SMILES notation for 2-dodecoxy-2-oxoacetate;1-dodecyl-3-methylimidazol-3-ium?
The canonical SMILES for 2-dodecoxy-2-oxoacetate;1-dodecyl-3-methylimidazol-3-ium is CCCCCCCCCCCCOC(=O)C(=O)[O-].CCCCCCCCCCCCn1cc[n+](C)c1.
What is the InChIKey of 2-dodecoxy-2-oxoacetate;1-dodecyl-3-methylimidazol-3-ium?
The InChIKey is OGDVPFGJTXNFJB-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H31N2.C14H26O4/c1-3-4-5-6-7-8-9-10-11-12-13-18-15-14-17(2)16-18;1-2-3-4-5-6-7-8-9-10-11-12-18-14(17)13(15)16/h14-16H,3-13H2,1-2H3;2-12H2,1H3,(H,15,16)/q+1;/p-1.
What are the key properties of 2-dodecoxy-2-oxoacetate;1-dodecyl-3-methylimidazol-3-ium?
2-dodecoxy-2-oxoacetate;1-dodecyl-3-methylimidazol-3-ium has a molecular weight of 508.79 g/mol, XLogP of 6.43, 22 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dodecoxy-2-oxoacetate;1-dodecyl-3-methylimidazol-3-ium is sourced from PubChem (CID 90091614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).