C33H40ClN2O+ — CID 155789959
1-[6-[4-[2-adamantylidene-(4-chlorophenyl)methyl]phenoxy]hexyl]-3-methylimidazol-3-ium (PubChem CID 155789959) has the molecular formula C33H40ClN2O+ and a molecular weight of 516.15 g/mol. Its IUPAC name is 1-[6-[4-[2-adamantylidene-(4-chlorophenyl)methyl]phenoxy]hexyl]-3-methylimidazol-3-ium.
| Compound Name | 1-[6-[4-[2-adamantylidene-(4-chlorophenyl)methyl]phenoxy]hexyl]-3-methylimidazol-3-ium |
|---|---|
| PubChem CID | 155789959 |
| Molecular Formula | C33H40ClN2O+ |
| Molecular Weight | 516.15 g/mol |
| Exact Mass | 515.28 |
| IUPAC Name | 1-[6-[4-[2-adamantylidene-(4-chlorophenyl)methyl]phenoxy]hexyl]-3-methylimidazol-3-ium |
| SMILES | C[n+]1ccn(CCCCCCOc2ccc(C(=C3C4CC5CC(C4)CC3C5)c3ccc(Cl)cc3)cc2)c1 |
| InChI | InChI=1S/C33H40ClN2O/c1-35-15-16-36(23-35)14-4-2-3-5-17-37-31-12-8-27(9-13-31)32(26-6-10-30(34)11-7-26)33-28-19-24-18-25(21-28)22-29(33)20-24/h6-13,15-16,23-25,28-29H,2-5,14,17-22H2,1H3/q+1/b33-32- |
| InChIKey | VLZMPTFFKZCFFX-KARKAFJISA-N |
| XLogP | 7.86 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.15 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|