C45H72N2O6+2 — CID 155789920
6-[4-[2-adamantylidene-[4-[6-[bis(2-hydroxyethyl)-methylazaniumyl]hexoxy]phenyl]methyl]phenoxy]hexyl-bis(2-hydroxyethyl)-methylazanium (PubChem CID 155789920) has the molecular formula C45H72N2O6+2 and a molecular weight of 737.08 g/mol. Its IUPAC name is 6-[4-[2-adamantylidene-[4-[6-[bis(2-hydroxyethyl)-methylazaniumyl]hexoxy]phenyl]methyl]phenoxy]hexyl-bis(2-hydroxyethyl)-methylazanium.
| Compound Name | 6-[4-[2-adamantylidene-[4-[6-[bis(2-hydroxyethyl)-methylazaniumyl]hexoxy]phenyl]methyl]phenoxy]hexyl-bis(2-hydroxyethyl)-methylazanium |
|---|---|
| PubChem CID | 155789920 |
| Molecular Formula | C45H72N2O6+2 |
| Molecular Weight | 737.08 g/mol |
| Exact Mass | 736.54 |
| IUPAC Name | 6-[4-[2-adamantylidene-[4-[6-[bis(2-hydroxyethyl)-methylazaniumyl]hexoxy]phenyl]methyl]phenoxy]hexyl-bis(2-hydroxyethyl)-methylazanium |
| SMILES | C[N+](CCO)(CCO)CCCCCCOc1ccc(C(=C2C3CC4CC(C3)CC2C4)c2ccc(OCCCCCC[N+](C)(CCO)CCO)cc2)cc1 |
| InChI | InChI=1S/C45H72N2O6/c1-46(21-25-48,22-26-49)19-7-3-5-9-29-52-42-15-11-38(12-16-42)44(45-40-32-36-31-37(34-40)35-41(45)33-36)39-13-17-43(18-14-39)53-30-10-6-4-8-20-47(2,23-27-50)24-28-51/h11-18,36-37,40-41,48-51H,3-10,19-35H2,1-2H3/q+2 |
| InChIKey | CKMJCCNHHDHWSY-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.08 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|