C47H72N2O2+2 — CID 155789958
1-[5-[4-[2-adamantylidene-[4-[5-(1-methylazepan-1-ium-1-yl)pentoxy]phenyl]methyl]phenoxy]pentyl]-1-methylazepan-1-ium (PubChem CID 155789958) has the molecular formula C47H72N2O2+2 and a molecular weight of 697.10 g/mol. Its IUPAC name is 1-[5-[4-[2-adamantylidene-[4-[5-(1-methylazepan-1-ium-1-yl)pentoxy]phenyl]methyl]phenoxy]pentyl]-1-methylazepan-1-ium.
| Compound Name | 1-[5-[4-[2-adamantylidene-[4-[5-(1-methylazepan-1-ium-1-yl)pentoxy]phenyl]methyl]phenoxy]pentyl]-1-methylazepan-1-ium |
|---|---|
| PubChem CID | 155789958 |
| Molecular Formula | C47H72N2O2+2 |
| Molecular Weight | 697.10 g/mol |
| Exact Mass | 696.56 |
| IUPAC Name | 1-[5-[4-[2-adamantylidene-[4-[5-(1-methylazepan-1-ium-1-yl)pentoxy]phenyl]methyl]phenoxy]pentyl]-1-methylazepan-1-ium |
| SMILES | C[N+]1(CCCCCOc2ccc(C(=C3C4CC5CC(C4)CC3C5)c3ccc(OCCCCC[N+]4(C)CCCCCC4)cc3)cc2)CCCCCC1 |
| InChI | InChI=1S/C47H72N2O2/c1-48(25-9-3-4-10-26-48)29-13-7-15-31-50-44-21-17-40(18-22-44)46(47-42-34-38-33-39(36-42)37-43(47)35-38)41-19-23-45(24-20-41)51-32-16-8-14-30-49(2)27-11-5-6-12-28-49/h17-24,38-39,42-43H,3-16,25-37H2,1-2H3/q+2 |
| InChIKey | WCBVXVQUUWZAFR-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.10 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|