C49H76N2O2+2 — CID 155789964
1-[6-[4-[2-adamantylidene-[4-[6-(1-methylazepan-1-ium-1-yl)hexoxy]phenyl]methyl]phenoxy]hexyl]-1-methylazepan-1-ium (PubChem CID 155789964) has the molecular formula C49H76N2O2+2 and a molecular weight of 725.16 g/mol. Its IUPAC name is 1-[6-[4-[2-adamantylidene-[4-[6-(1-methylazepan-1-ium-1-yl)hexoxy]phenyl]methyl]phenoxy]hexyl]-1-methylazepan-1-ium.
| Compound Name | 1-[6-[4-[2-adamantylidene-[4-[6-(1-methylazepan-1-ium-1-yl)hexoxy]phenyl]methyl]phenoxy]hexyl]-1-methylazepan-1-ium |
|---|---|
| PubChem CID | 155789964 |
| Molecular Formula | C49H76N2O2+2 |
| Molecular Weight | 725.16 g/mol |
| Exact Mass | 724.59 |
| IUPAC Name | 1-[6-[4-[2-adamantylidene-[4-[6-(1-methylazepan-1-ium-1-yl)hexoxy]phenyl]methyl]phenoxy]hexyl]-1-methylazepan-1-ium |
| SMILES | C[N+]1(CCCCCCOc2ccc(C(=C3C4CC5CC(C4)CC3C5)c3ccc(OCCCCCC[N+]4(C)CCCCCC4)cc3)cc2)CCCCCC1 |
| InChI | InChI=1S/C49H76N2O2/c1-50(27-11-3-4-12-28-50)31-15-7-9-17-33-52-46-23-19-42(20-24-46)48(49-44-36-40-35-41(38-44)39-45(49)37-40)43-21-25-47(26-22-43)53-34-18-10-8-16-32-51(2)29-13-5-6-14-30-51/h19-26,40-41,44-45H,3-18,27-39H2,1-2H3/q+2 |
| InChIKey | MJCCPKDNUJDXOO-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.16 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|