C43H64I2N2O3 — CID 175104109
[1-[4-[4-[2-adamantylidene-[4-[4-(1-methylpiperidin-1-ium-1-yl)butoxy]phenyl]methyl]phenoxy]butyl]piperidin-1-ium-1-yl]methanol diiodide (PubChem CID 175104109) has the molecular formula C43H64I2N2O3 and a molecular weight of 910.80 g/mol. Its IUPAC name is [1-[4-[4-[2-adamantylidene-[4-[4-(1-methylpiperidin-1-ium-1-yl)butoxy]phenyl]methyl]phenoxy]butyl]piperidin-1-ium-1-yl]methanol diiodide.
| Compound Name | [1-[4-[4-[2-adamantylidene-[4-[4-(1-methylpiperidin-1-ium-1-yl)butoxy]phenyl]methyl]phenoxy]butyl]piperidin-1-ium-1-yl]methanol diiodide |
|---|---|
| PubChem CID | 175104109 |
| Molecular Formula | C43H64I2N2O3 |
| Molecular Weight | 910.80 g/mol |
| Exact Mass | 910.30 |
| IUPAC Name | [1-[4-[4-[2-adamantylidene-[4-[4-(1-methylpiperidin-1-ium-1-yl)butoxy]phenyl]methyl]phenoxy]butyl]piperidin-1-ium-1-yl]methanol diiodide |
| SMILES | C[N+]1(CCCCOc2ccc(C(=C3C4CC5CC(C4)CC3C5)c3ccc(OCCCC[N+]4(CO)CCCCC4)cc3)cc2)CCCCC1.[I-].[I-] |
| InChI | InChI=1S/C43H64N2O3.2HI/c1-44(20-4-2-5-21-44)22-8-10-26-47-40-16-12-36(13-17-40)42(43-38-29-34-28-35(31-38)32-39(43)30-34)37-14-18-41(19-15-37)48-27-11-9-25-45(33-46)23-6-3-7-24-45;;/h12-19,34-35,38-39,46H,2-11,20-33H2,1H3;2*1H/q+2;;/p-2/b43-42-;; |
| InChIKey | DUOJWILSWWOTDM-HWDRCIJUSA-L |
| XLogP | 2.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.80 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|