C44H70N2O4+2 — CID 124862236
(2S,5R)-2,5-bis[(1-methylazepan-1-ium-1-yl)methyl]-1,6-bis(4-pentoxyphenyl)hexane-1,6-dione (PubChem CID 124862236) has the molecular formula C44H70N2O4+2 and a molecular weight of 691.05 g/mol. Its IUPAC name is (2S,5R)-2,5-bis[(1-methylazepan-1-ium-1-yl)methyl]-1,6-bis(4-pentoxyphenyl)hexane-1,6-dione.
| Compound Name | (2S,5R)-2,5-bis[(1-methylazepan-1-ium-1-yl)methyl]-1,6-bis(4-pentoxyphenyl)hexane-1,6-dione |
|---|---|
| PubChem CID | 124862236 |
| Molecular Formula | C44H70N2O4+2 |
| Molecular Weight | 691.05 g/mol |
| Exact Mass | 690.53 |
| IUPAC Name | (2S,5R)-2,5-bis[(1-methylazepan-1-ium-1-yl)methyl]-1,6-bis(4-pentoxyphenyl)hexane-1,6-dione |
| SMILES | CCCCCOc1ccc(C(=O)[C@H](CC[C@@H](C[N+]2(C)CCCCCC2)C(=O)c2ccc(OCCCCC)cc2)C[N+]2(C)CCCCCC2)cc1 |
| InChI | InChI=1S/C44H70N2O4/c1-5-7-17-33-49-41-25-21-37(22-26-41)43(47)39(35-45(3)29-13-9-10-14-30-45)19-20-40(36-46(4)31-15-11-12-16-32-46)44(48)38-23-27-42(28-24-38)50-34-18-8-6-2/h21-28,39-40H,5-20,29-36H2,1-4H3/q+2/t39-,40+ |
| InChIKey | MAJOPTQHANGDBV-LQDDJWCHSA-N |
| XLogP | 9.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.05 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|