C40H60N2O4 — CID 3078330
2,7-bis(azepan-1-ylmethyl)-1,8-bis(4-propoxyphenyl)octane-1,8-dione (PubChem CID 3078330) has the molecular formula C40H60N2O4 and a molecular weight of 632.93 g/mol. Its IUPAC name is 2,7-bis(azepan-1-ylmethyl)-1,8-bis(4-propoxyphenyl)octane-1,8-dione.
| Compound Name | 2,7-bis(azepan-1-ylmethyl)-1,8-bis(4-propoxyphenyl)octane-1,8-dione |
|---|---|
| PubChem CID | 3078330 |
| Molecular Formula | C40H60N2O4 |
| Molecular Weight | 632.93 g/mol |
| Exact Mass | 632.46 |
| IUPAC Name | 2,7-bis(azepan-1-ylmethyl)-1,8-bis(4-propoxyphenyl)octane-1,8-dione |
| SMILES | CCCOc1ccc(C(=O)C(CCCCC(CN2CCCCCC2)C(=O)c2ccc(OCCC)cc2)CN2CCCCCC2)cc1 |
| InChI | InChI=1S/C40H60N2O4/c1-3-29-45-37-21-17-33(18-22-37)39(43)35(31-41-25-11-5-6-12-26-41)15-9-10-16-36(32-42-27-13-7-8-14-28-42)40(44)34-19-23-38(24-20-34)46-30-4-2/h17-24,35-36H,3-16,25-32H2,1-2H3 |
| InChIKey | HTALCJICAPPBCH-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.93 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|