C35H50N2O4 — CID 97292408
(2R,4R)-2,4-bis(azepan-1-ylmethyl)-1,5-bis(4-ethoxyphenyl)pentane-1,5-dione (PubChem CID 97292408) has the molecular formula C35H50N2O4 and a molecular weight of 562.80 g/mol. Its IUPAC name is (2R,4R)-2,4-bis(azepan-1-ylmethyl)-1,5-bis(4-ethoxyphenyl)pentane-1,5-dione.
| Compound Name | (2R,4R)-2,4-bis(azepan-1-ylmethyl)-1,5-bis(4-ethoxyphenyl)pentane-1,5-dione |
|---|---|
| PubChem CID | 97292408 |
| Molecular Formula | C35H50N2O4 |
| Molecular Weight | 562.80 g/mol |
| Exact Mass | 562.38 |
| IUPAC Name | (2R,4R)-2,4-bis(azepan-1-ylmethyl)-1,5-bis(4-ethoxyphenyl)pentane-1,5-dione |
| SMILES | CCOc1ccc(C(=O)[C@H](C[C@H](CN2CCCCCC2)C(=O)c2ccc(OCC)cc2)CN2CCCCCC2)cc1 |
| InChI | InChI=1S/C35H50N2O4/c1-3-40-32-17-13-28(14-18-32)34(38)30(26-36-21-9-5-6-10-22-36)25-31(27-37-23-11-7-8-12-24-37)35(39)29-15-19-33(20-16-29)41-4-2/h13-20,30-31H,3-12,21-27H2,1-2H3/t30-,31-/m1/s1 |
| InChIKey | CHGIQXRICGGUOO-FIRIVFDPSA-N |
| XLogP | 6.92 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.80 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |