C17H27N2O3+ — CID 102464332
(4-ethoxyphenyl)-[(2S)-1-piperidin-1-ylpropan-2-yl]oxycarbonylazanium (PubChem CID 102464332) has the molecular formula C17H27N2O3+ and a molecular weight of 307.41 g/mol. Its IUPAC name is (4-ethoxyphenyl)-[(2S)-1-piperidin-1-ylpropan-2-yl]oxycarbonylazanium.
| Compound Name | (4-ethoxyphenyl)-[(2S)-1-piperidin-1-ylpropan-2-yl]oxycarbonylazanium |
|---|---|
| PubChem CID | 102464332 |
| Molecular Formula | C17H27N2O3+ |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | (4-ethoxyphenyl)-[(2S)-1-piperidin-1-ylpropan-2-yl]oxycarbonylazanium |
| SMILES | CCOc1ccc([NH2+]C(=O)O[C@@H](C)CN2CCCCC2)cc1 |
| InChI | InChI=1S/C17H26N2O3/c1-3-21-16-9-7-15(8-10-16)18-17(20)22-14(2)13-19-11-5-4-6-12-19/h7-10,14H,3-6,11-13H2,1-2H3,(H,18,20)/p+1/t14-/m0/s1 |
| InChIKey | LFQTTWOVAJBALG-AWEZNQCLSA-O |
| XLogP | 2.29 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|