C43H66N2O6 — CID 155789979
2-[6-[4-[2-adamantylidene-[4-[6-[bis(2-hydroxyethyl)amino]hexoxy]phenyl]methyl]phenoxy]hexyl-(2-hydroxyethyl)amino]ethanol (PubChem CID 155789979) has the molecular formula C43H66N2O6 and a molecular weight of 707.01 g/mol. Its IUPAC name is 2-[6-[4-[2-adamantylidene-[4-[6-[bis(2-hydroxyethyl)amino]hexoxy]phenyl]methyl]phenoxy]hexyl-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[6-[4-[2-adamantylidene-[4-[6-[bis(2-hydroxyethyl)amino]hexoxy]phenyl]methyl]phenoxy]hexyl-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 155789979 |
| Molecular Formula | C43H66N2O6 |
| Molecular Weight | 707.01 g/mol |
| Exact Mass | 706.49 |
| IUPAC Name | 2-[6-[4-[2-adamantylidene-[4-[6-[bis(2-hydroxyethyl)amino]hexoxy]phenyl]methyl]phenoxy]hexyl-(2-hydroxyethyl)amino]ethanol |
| SMILES | OCCN(CCO)CCCCCCOc1ccc(C(=C2C3CC4CC(C3)CC2C4)c2ccc(OCCCCCCN(CCO)CCO)cc2)cc1 |
| InChI | InChI=1S/C43H66N2O6/c46-23-19-44(20-24-47)17-5-1-3-7-27-50-40-13-9-36(10-14-40)42(43-38-30-34-29-35(32-38)33-39(43)31-34)37-11-15-41(16-12-37)51-28-8-4-2-6-18-45(21-25-48)22-26-49/h9-16,34-35,38-39,46-49H,1-8,17-33H2 |
| InChIKey | SWLJMFKPFSWOTM-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.01 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|