About 4-[2-adamantylidene-[4-(3-aminopropoxy)phenyl]methyl]phenol;3-aminopropan-1-ol
4-[2-adamantylidene-[4-(3-aminopropoxy)phenyl]methyl]phenol;3-aminopropan-1-ol (PubChem CID 160816106) has the molecular formula C29H40N2O3
and a molecular weight of 464.65 g/mol. Its IUPAC name is 4-[2-adamantylidene-[4-(3-aminopropoxy)phenyl]methyl]phenol;3-aminopropan-1-ol.
Molecular Properties
| Compound Name | 4-[2-adamantylidene-[4-(3-aminopropoxy)phenyl]methyl]phenol;3-aminopropan-1-ol |
| PubChem CID | 160816106 |
| Molecular Formula | C29H40N2O3 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | 4-[2-adamantylidene-[4-(3-aminopropoxy)phenyl]methyl]phenol;3-aminopropan-1-ol |
| SMILES | NCCCO.NCCCOc1ccc(C(=C2C3CC4CC(C3)CC2C4)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C26H31NO2.C3H9NO/c27-10-1-11-29-24-8-4-20(5-9-24)25(19-2-6-23(28)7-3-19)26-21-13-17-12-18(15-21)16-22(26)14-17;4-2-1-3-5/h2-9,17-18,21-22,28H,1,10-16,27H2;5H,1-4H2/b26-25-; |
| InChIKey | SEXQQZRPAQMERV-OQKDUQJOSA-N |
| XLogP | 4.71 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-adamantylidene-[4-(3-aminopropoxy)phenyl]methyl]phenol;3-aminopropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-adamantylidene-[4-(3-aminopropoxy)phenyl]methyl]phenol;3-aminopropan-1-ol?
The IUPAC name of 4-[2-adamantylidene-[4-(3-aminopropoxy)phenyl]methyl]phenol;3-aminopropan-1-ol (CID 160816106) is 4-[2-adamantylidene-[4-(3-aminopropoxy)phenyl]methyl]phenol;3-aminopropan-1-ol.
What is the SMILES notation for 4-[2-adamantylidene-[4-(3-aminopropoxy)phenyl]methyl]phenol;3-aminopropan-1-ol?
The canonical SMILES for 4-[2-adamantylidene-[4-(3-aminopropoxy)phenyl]methyl]phenol;3-aminopropan-1-ol is NCCCO.NCCCOc1ccc(C(=C2C3CC4CC(C3)CC2C4)c2ccc(O)cc2)cc1.
What is the InChIKey of 4-[2-adamantylidene-[4-(3-aminopropoxy)phenyl]methyl]phenol;3-aminopropan-1-ol?
The InChIKey is SEXQQZRPAQMERV-OQKDUQJOSA-N. The full InChI is InChI=1S/C26H31NO2.C3H9NO/c27-10-1-11-29-24-8-4-20(5-9-24)25(19-2-6-23(28)7-3-19)26-21-13-17-12-18(15-21)16-22(26)14-17;4-2-1-3-5/h2-9,17-18,21-22,28H,1,10-16,27H2;5H,1-4H2/b26-25-;.
What are the key properties of 4-[2-adamantylidene-[4-(3-aminopropoxy)phenyl]methyl]phenol;3-aminopropan-1-ol?
4-[2-adamantylidene-[4-(3-aminopropoxy)phenyl]methyl]phenol;3-aminopropan-1-ol has a molecular weight of 464.65 g/mol, XLogP of 4.71, 8 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-adamantylidene-[4-(3-aminopropoxy)phenyl]methyl]phenol;3-aminopropan-1-ol is sourced from PubChem (CID 160816106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).