C29H40N2O3 — CID 160816106
4-[2-adamantylidene-[4-(3-aminopropoxy)phenyl]methyl]phenol;3-aminopropan-1-ol (PubChem CID 160816106) has the molecular formula C29H40N2O3 and a molecular weight of 464.65 g/mol. Its IUPAC name is 4-[2-adamantylidene-[4-(3-aminopropoxy)phenyl]methyl]phenol;3-aminopropan-1-ol.
| Compound Name | 4-[2-adamantylidene-[4-(3-aminopropoxy)phenyl]methyl]phenol;3-aminopropan-1-ol |
|---|---|
| PubChem CID | 160816106 |
| Molecular Formula | C29H40N2O3 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | 4-[2-adamantylidene-[4-(3-aminopropoxy)phenyl]methyl]phenol;3-aminopropan-1-ol |
| SMILES | NCCCO.NCCCOc1ccc(C(=C2C3CC4CC(C3)CC2C4)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C26H31NO2.C3H9NO/c27-10-1-11-29-24-8-4-20(5-9-24)25(19-2-6-23(28)7-3-19)26-21-13-17-12-18(15-21)16-22(26)14-17;4-2-1-3-5/h2-9,17-18,21-22,28H,1,10-16,27H2;5H,1-4H2/b26-25-; |
| InChIKey | SEXQQZRPAQMERV-OQKDUQJOSA-N |
| XLogP | 4.71 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|