C36H47NO3 — CID 153374591
N-[4-[4-[2-adamantylidene-(4-hydroxyphenyl)methyl]phenoxy]butyl]-3-cyclohexylpropanamide (PubChem CID 153374591) has the molecular formula C36H47NO3 and a molecular weight of 541.78 g/mol. Its IUPAC name is N-[4-[4-[2-adamantylidene-(4-hydroxyphenyl)methyl]phenoxy]butyl]-3-cyclohexylpropanamide.
| Compound Name | N-[4-[4-[2-adamantylidene-(4-hydroxyphenyl)methyl]phenoxy]butyl]-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 153374591 |
| Molecular Formula | C36H47NO3 |
| Molecular Weight | 541.78 g/mol |
| Exact Mass | 541.36 |
| IUPAC Name | N-[4-[4-[2-adamantylidene-(4-hydroxyphenyl)methyl]phenoxy]butyl]-3-cyclohexylpropanamide |
| SMILES | O=C(CCC1CCCCC1)NCCCCOc1ccc(C(=C2C3CC4CC(C3)CC2C4)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C36H47NO3/c38-32-13-9-28(10-14-32)35(36-30-21-26-20-27(23-30)24-31(36)22-26)29-11-15-33(16-12-29)40-19-5-4-18-37-34(39)17-8-25-6-2-1-3-7-25/h9-16,25-27,30-31,38H,1-8,17-24H2,(H,37,39)/b36-35- |
| InChIKey | WPEIMDCKTBVYKE-KXYMVQBMSA-N |
| XLogP | 8.29 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.78 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|