C35H47N3O2 — CID 175096982
2-[[4-(6-azidohexoxy)phenyl]-(4-hexoxyphenyl)methylidene]adamantane (PubChem CID 175096982) has the molecular formula C35H47N3O2 and a molecular weight of 541.78 g/mol. Its IUPAC name is 2-[[4-(6-azidohexoxy)phenyl]-(4-hexoxyphenyl)methylidene]adamantane.
| Compound Name | 2-[[4-(6-azidohexoxy)phenyl]-(4-hexoxyphenyl)methylidene]adamantane |
|---|---|
| PubChem CID | 175096982 |
| Molecular Formula | C35H47N3O2 |
| Molecular Weight | 541.78 g/mol |
| Exact Mass | 541.37 |
| IUPAC Name | 2-[[4-(6-azidohexoxy)phenyl]-(4-hexoxyphenyl)methylidene]adamantane |
| SMILES | CCCCCCOc1ccc(C(=C2C3CC4CC(C3)CC2C4)c2ccc(OCCCCCCN=[N+]=[N-])cc2)cc1 |
| InChI | InChI=1S/C35H47N3O2/c1-2-3-4-8-19-39-32-14-10-28(11-15-32)34(35-30-22-26-21-27(24-30)25-31(35)23-26)29-12-16-33(17-13-29)40-20-9-6-5-7-18-37-38-36/h10-17,26-27,30-31H,2-9,18-25H2,1H3/b35-34- |
| InChIKey | BZGNZWSVSCZCCU-KNWKATPGSA-N |
| XLogP | 10.15 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.78 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|