C15H23N3O3 — CID 170827229
3-azido-1-(4-hexoxyphenyl)propane-1,2-diol (PubChem CID 170827229) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-azido-1-(4-hexoxyphenyl)propane-1,2-diol.
| Compound Name | 3-azido-1-(4-hexoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170827229 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 3-azido-1-(4-hexoxyphenyl)propane-1,2-diol |
| SMILES | CCCCCCOc1ccc(C(O)C(O)CN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C15H23N3O3/c1-2-3-4-5-10-21-13-8-6-12(7-9-13)15(20)14(19)11-17-18-16/h6-9,14-15,19-20H,2-5,10-11H2,1H3 |
| InChIKey | WYXRXHCTTIJBHL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|