C19H31NO4 — CID 170831241
N-[2,3-dihydroxy-3-(4-octoxyphenyl)propyl]acetamide (PubChem CID 170831241) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is N-[2,3-dihydroxy-3-(4-octoxyphenyl)propyl]acetamide.
| Compound Name | N-[2,3-dihydroxy-3-(4-octoxyphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 170831241 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | N-[2,3-dihydroxy-3-(4-octoxyphenyl)propyl]acetamide |
| SMILES | CCCCCCCCOc1ccc(C(O)C(O)CNC(C)=O)cc1 |
| InChI | InChI=1S/C19H31NO4/c1-3-4-5-6-7-8-13-24-17-11-9-16(10-12-17)19(23)18(22)14-20-15(2)21/h9-12,18-19,22-23H,3-8,13-14H2,1-2H3,(H,20,21) |
| InChIKey | WTPBHLYJEIHFNF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|