C13H17NO5 — CID 170831378
[4-(3-acetamido-1,2-dihydroxypropyl)phenyl] acetate (PubChem CID 170831378) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is [4-(3-acetamido-1,2-dihydroxypropyl)phenyl] acetate.
| Compound Name | [4-(3-acetamido-1,2-dihydroxypropyl)phenyl] acetate |
|---|---|
| PubChem CID | 170831378 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | [4-(3-acetamido-1,2-dihydroxypropyl)phenyl] acetate |
| SMILES | CC(=O)NCC(O)C(O)c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C13H17NO5/c1-8(15)14-7-12(17)13(18)10-3-5-11(6-4-10)19-9(2)16/h3-6,12-13,17-18H,7H2,1-2H3,(H,14,15) |
| InChIKey | XEZZWYYJVVFPOV-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|