C15H21NO5 — CID 170830919
ethyl 2-[4-(3-acetamido-1,2-dihydroxypropyl)phenyl]acetate (PubChem CID 170830919) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is ethyl 2-[4-(3-acetamido-1,2-dihydroxypropyl)phenyl]acetate.
| Compound Name | ethyl 2-[4-(3-acetamido-1,2-dihydroxypropyl)phenyl]acetate |
|---|---|
| PubChem CID | 170830919 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | ethyl 2-[4-(3-acetamido-1,2-dihydroxypropyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(C(O)C(O)CNC(C)=O)cc1 |
| InChI | InChI=1S/C15H21NO5/c1-3-21-14(19)8-11-4-6-12(7-5-11)15(20)13(18)9-16-10(2)17/h4-7,13,15,18,20H,3,8-9H2,1-2H3,(H,16,17) |
| InChIKey | AMORROXTNXCWBR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |