C18H25NO6 — CID 171884080
ethyl 4-[4-(4-acetamido-1,2-dihydroxybutyl)phenyl]-4-oxobutanoate (PubChem CID 171884080) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is ethyl 4-[4-(4-acetamido-1,2-dihydroxybutyl)phenyl]-4-oxobutanoate.
| Compound Name | ethyl 4-[4-(4-acetamido-1,2-dihydroxybutyl)phenyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 171884080 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | ethyl 4-[4-(4-acetamido-1,2-dihydroxybutyl)phenyl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)c1ccc(C(O)C(O)CCNC(C)=O)cc1 |
| InChI | InChI=1S/C18H25NO6/c1-3-25-17(23)9-8-15(21)13-4-6-14(7-5-13)18(24)16(22)10-11-19-12(2)20/h4-7,16,18,22,24H,3,8-11H2,1-2H3,(H,19,20) |
| InChIKey | UFDTTXJVCNPFAU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |