C13H18O4S — CID 170820737
ethyl 2-[4-(1,2-dihydroxy-3-sulfanylpropyl)phenyl]acetate (PubChem CID 170820737) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is ethyl 2-[4-(1,2-dihydroxy-3-sulfanylpropyl)phenyl]acetate.
| Compound Name | ethyl 2-[4-(1,2-dihydroxy-3-sulfanylpropyl)phenyl]acetate |
|---|---|
| PubChem CID | 170820737 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | ethyl 2-[4-(1,2-dihydroxy-3-sulfanylpropyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(C(O)C(O)CS)cc1 |
| InChI | InChI=1S/C13H18O4S/c1-2-17-12(15)7-9-3-5-10(6-4-9)13(16)11(14)8-18/h3-6,11,13-14,16,18H,2,7-8H2,1H3 |
| InChIKey | PKIQZYOVCZITPP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|