C17H28O3 — CID 77411526
1-(4-methoxyphenyl)decane-1,2-diol (PubChem CID 77411526) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)decane-1,2-diol.
| Compound Name | 1-(4-methoxyphenyl)decane-1,2-diol |
|---|---|
| PubChem CID | 77411526 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 1-(4-methoxyphenyl)decane-1,2-diol |
| SMILES | CCCCCCCCC(O)C(O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H28O3/c1-3-4-5-6-7-8-9-16(18)17(19)14-10-12-15(20-2)13-11-14/h10-13,16-19H,3-9H2,1-2H3 |
| InChIKey | CUNQUYYZXRPKNM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|