C29H32F2N3O+ — CID 177446070
3,5-difluoro-4-[2-[4-[10-(3-methylimidazol-3-ium-1-yl)decoxy]phenyl]ethynyl]benzonitrile (PubChem CID 177446070) has the molecular formula C29H32F2N3O+ and a molecular weight of 476.59 g/mol. Its IUPAC name is 3,5-difluoro-4-[2-[4-[10-(3-methylimidazol-3-ium-1-yl)decoxy]phenyl]ethynyl]benzonitrile.
| Compound Name | 3,5-difluoro-4-[2-[4-[10-(3-methylimidazol-3-ium-1-yl)decoxy]phenyl]ethynyl]benzonitrile |
|---|---|
| PubChem CID | 177446070 |
| Molecular Formula | C29H32F2N3O+ |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 3,5-difluoro-4-[2-[4-[10-(3-methylimidazol-3-ium-1-yl)decoxy]phenyl]ethynyl]benzonitrile |
| SMILES | C[n+]1ccn(CCCCCCCCCCOc2ccc(C#Cc3c(F)cc(C#N)cc3F)cc2)c1 |
| InChI | InChI=1S/C29H32F2N3O/c1-33-17-18-34(23-33)16-8-6-4-2-3-5-7-9-19-35-26-13-10-24(11-14-26)12-15-27-28(30)20-25(22-32)21-29(27)31/h10-11,13-14,17-18,20-21,23H,2-9,16,19H2,1H3/q+1 |
| InChIKey | GKLNTBATFIDKAV-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 41.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|