C30H34F2O2S — CID 46849972
S-[6-[3,5-difluoro-4-[2-(4-octoxyphenyl)ethynyl]phenyl]hex-5-ynyl] ethanethioate (PubChem CID 46849972) has the molecular formula C30H34F2O2S and a molecular weight of 496.66 g/mol. Its IUPAC name is S-[6-[3,5-difluoro-4-[2-(4-octoxyphenyl)ethynyl]phenyl]hex-5-ynyl] ethanethioate.
| Compound Name | S-[6-[3,5-difluoro-4-[2-(4-octoxyphenyl)ethynyl]phenyl]hex-5-ynyl] ethanethioate |
|---|---|
| PubChem CID | 46849972 |
| Molecular Formula | C30H34F2O2S |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | S-[6-[3,5-difluoro-4-[2-(4-octoxyphenyl)ethynyl]phenyl]hex-5-ynyl] ethanethioate |
| SMILES | CCCCCCCCOc1ccc(C#Cc2c(F)cc(C#CCCCCSC(C)=O)cc2F)cc1 |
| InChI | InChI=1S/C30H34F2O2S/c1-3-4-5-6-8-11-20-34-27-17-14-25(15-18-27)16-19-28-29(31)22-26(23-30(28)32)13-10-7-9-12-21-35-24(2)33/h14-15,17-18,22-23H,3-9,11-12,20-21H2,1-2H3 |
| InChIKey | LZZIZYYHNKMOBO-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|