C28H25F3O3 — CID 102373128
[2,6-difluoro-4-[2-(4-heptoxyphenyl)ethynyl]phenyl] 4-fluorobenzoate (PubChem CID 102373128) has the molecular formula C28H25F3O3 and a molecular weight of 466.50 g/mol. Its IUPAC name is [2,6-difluoro-4-[2-(4-heptoxyphenyl)ethynyl]phenyl] 4-fluorobenzoate.
| Compound Name | [2,6-difluoro-4-[2-(4-heptoxyphenyl)ethynyl]phenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 102373128 |
| Molecular Formula | C28H25F3O3 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | [2,6-difluoro-4-[2-(4-heptoxyphenyl)ethynyl]phenyl] 4-fluorobenzoate |
| SMILES | CCCCCCCOc1ccc(C#Cc2cc(F)c(OC(=O)c3ccc(F)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C28H25F3O3/c1-2-3-4-5-6-17-33-24-15-9-20(10-16-24)7-8-21-18-25(30)27(26(31)19-21)34-28(32)22-11-13-23(29)14-12-22/h9-16,18-19H,2-6,17H2,1H3 |
| InChIKey | UQTVYHKGVSBWCN-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|