C28H26F2O3 — CID 102018030
(3,5-difluorophenyl) 4-[2-(4-heptoxyphenyl)ethynyl]benzoate (PubChem CID 102018030) has the molecular formula C28H26F2O3 and a molecular weight of 448.51 g/mol. Its IUPAC name is (3,5-difluorophenyl) 4-[2-(4-heptoxyphenyl)ethynyl]benzoate.
| Compound Name | (3,5-difluorophenyl) 4-[2-(4-heptoxyphenyl)ethynyl]benzoate |
|---|---|
| PubChem CID | 102018030 |
| Molecular Formula | C28H26F2O3 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | (3,5-difluorophenyl) 4-[2-(4-heptoxyphenyl)ethynyl]benzoate |
| SMILES | CCCCCCCOc1ccc(C#Cc2ccc(C(=O)Oc3cc(F)cc(F)c3)cc2)cc1 |
| InChI | InChI=1S/C28H26F2O3/c1-2-3-4-5-6-17-32-26-15-11-22(12-16-26)8-7-21-9-13-23(14-10-21)28(31)33-27-19-24(29)18-25(30)20-27/h9-16,18-20H,2-6,17H2,1H3 |
| InChIKey | NHEUIIARWCUYGI-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|