C27H24F2O3 — CID 102018045
(2,6-difluorophenyl) 4-[2-(4-hexoxyphenyl)ethynyl]benzoate (PubChem CID 102018045) has the molecular formula C27H24F2O3 and a molecular weight of 434.48 g/mol. Its IUPAC name is (2,6-difluorophenyl) 4-[2-(4-hexoxyphenyl)ethynyl]benzoate.
| Compound Name | (2,6-difluorophenyl) 4-[2-(4-hexoxyphenyl)ethynyl]benzoate |
|---|---|
| PubChem CID | 102018045 |
| Molecular Formula | C27H24F2O3 |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | (2,6-difluorophenyl) 4-[2-(4-hexoxyphenyl)ethynyl]benzoate |
| SMILES | CCCCCCOc1ccc(C#Cc2ccc(C(=O)Oc3c(F)cccc3F)cc2)cc1 |
| InChI | InChI=1S/C27H24F2O3/c1-2-3-4-5-19-31-23-17-13-21(14-18-23)10-9-20-11-15-22(16-12-20)27(30)32-26-24(28)7-6-8-25(26)29/h6-8,11-18H,2-5,19H2,1H3 |
| InChIKey | MSZIIRIFFBQYOF-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|