C27H23F3O3 — CID 102373127
[2,6-difluoro-4-[2-(4-hexoxyphenyl)ethynyl]phenyl] 4-fluorobenzoate (PubChem CID 102373127) has the molecular formula C27H23F3O3 and a molecular weight of 452.47 g/mol. Its IUPAC name is [2,6-difluoro-4-[2-(4-hexoxyphenyl)ethynyl]phenyl] 4-fluorobenzoate.
| Compound Name | [2,6-difluoro-4-[2-(4-hexoxyphenyl)ethynyl]phenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 102373127 |
| Molecular Formula | C27H23F3O3 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | [2,6-difluoro-4-[2-(4-hexoxyphenyl)ethynyl]phenyl] 4-fluorobenzoate |
| SMILES | CCCCCCOc1ccc(C#Cc2cc(F)c(OC(=O)c3ccc(F)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C27H23F3O3/c1-2-3-4-5-16-32-23-14-8-19(9-15-23)6-7-20-17-24(29)26(25(30)18-20)33-27(31)21-10-12-22(28)13-11-21/h8-15,17-18H,2-5,16H2,1H3 |
| InChIKey | XGMXGBQMRMTVAJ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|