C29H27F3O3 — CID 102018013
(3,4,5-trifluorophenyl) 4-[2-(4-octoxyphenyl)ethynyl]benzoate (PubChem CID 102018013) has the molecular formula C29H27F3O3 and a molecular weight of 480.53 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 4-[2-(4-octoxyphenyl)ethynyl]benzoate.
| Compound Name | (3,4,5-trifluorophenyl) 4-[2-(4-octoxyphenyl)ethynyl]benzoate |
|---|---|
| PubChem CID | 102018013 |
| Molecular Formula | C29H27F3O3 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | (3,4,5-trifluorophenyl) 4-[2-(4-octoxyphenyl)ethynyl]benzoate |
| SMILES | CCCCCCCCOc1ccc(C#Cc2ccc(C(=O)Oc3cc(F)c(F)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C29H27F3O3/c1-2-3-4-5-6-7-18-34-24-16-12-22(13-17-24)9-8-21-10-14-23(15-11-21)29(33)35-25-19-26(30)28(32)27(31)20-25/h10-17,19-20H,2-7,18H2,1H3 |
| InChIKey | DTJFGQTURWORPA-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|