C32H28F6O2 — CID 102017762
1-[2-[2,6-difluoro-4-[2-(4-pentoxyphenyl)ethynyl]phenyl]ethynyl]-2,3,5,6-tetrafluoro-4-pentoxybenzene (PubChem CID 102017762) has the molecular formula C32H28F6O2 and a molecular weight of 558.56 g/mol. Its IUPAC name is 1-[2-[2,6-difluoro-4-[2-(4-pentoxyphenyl)ethynyl]phenyl]ethynyl]-2,3,5,6-tetrafluoro-4-pentoxybenzene.
| Compound Name | 1-[2-[2,6-difluoro-4-[2-(4-pentoxyphenyl)ethynyl]phenyl]ethynyl]-2,3,5,6-tetrafluoro-4-pentoxybenzene |
|---|---|
| PubChem CID | 102017762 |
| Molecular Formula | C32H28F6O2 |
| Molecular Weight | 558.56 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 1-[2-[2,6-difluoro-4-[2-(4-pentoxyphenyl)ethynyl]phenyl]ethynyl]-2,3,5,6-tetrafluoro-4-pentoxybenzene |
| SMILES | CCCCCOc1ccc(C#Cc2cc(F)c(C#Cc3c(F)c(F)c(OCCCCC)c(F)c3F)c(F)c2)cc1 |
| InChI | InChI=1S/C32H28F6O2/c1-3-5-7-17-39-23-13-11-21(12-14-23)9-10-22-19-26(33)24(27(34)20-22)15-16-25-28(35)30(37)32(31(38)29(25)36)40-18-8-6-4-2/h11-14,19-20H,3-8,17-18H2,1-2H3 |
| InChIKey | MJIHGRRJRWOOQU-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.56 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|