C28H23F5O3 — CID 101051795
[4-[2-(2,3,5,6-tetrafluoro-4-heptoxyphenyl)ethynyl]phenyl] 3-fluorobenzoate (PubChem CID 101051795) has the molecular formula C28H23F5O3 and a molecular weight of 502.48 g/mol. Its IUPAC name is [4-[2-(2,3,5,6-tetrafluoro-4-heptoxyphenyl)ethynyl]phenyl] 3-fluorobenzoate.
| Compound Name | [4-[2-(2,3,5,6-tetrafluoro-4-heptoxyphenyl)ethynyl]phenyl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 101051795 |
| Molecular Formula | C28H23F5O3 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | [4-[2-(2,3,5,6-tetrafluoro-4-heptoxyphenyl)ethynyl]phenyl] 3-fluorobenzoate |
| SMILES | CCCCCCCOc1c(F)c(F)c(C#Cc2ccc(OC(=O)c3cccc(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C28H23F5O3/c1-2-3-4-5-6-16-35-27-25(32)23(30)22(24(31)26(27)33)15-12-18-10-13-21(14-11-18)36-28(34)19-8-7-9-20(29)17-19/h7-11,13-14,17H,2-6,16H2,1H3 |
| InChIKey | NIYFMSMTLCJXSI-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|