C26H18F4O2 — CID 122666384
4-[2-[4-[2-(4-butoxy-2,3,5,6-tetrafluorophenyl)ethynyl]phenyl]ethynyl]phenol (PubChem CID 122666384) has the molecular formula C26H18F4O2 and a molecular weight of 438.42 g/mol. Its IUPAC name is 4-[2-[4-[2-(4-butoxy-2,3,5,6-tetrafluorophenyl)ethynyl]phenyl]ethynyl]phenol.
| Compound Name | 4-[2-[4-[2-(4-butoxy-2,3,5,6-tetrafluorophenyl)ethynyl]phenyl]ethynyl]phenol |
|---|---|
| PubChem CID | 122666384 |
| Molecular Formula | C26H18F4O2 |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 4-[2-[4-[2-(4-butoxy-2,3,5,6-tetrafluorophenyl)ethynyl]phenyl]ethynyl]phenol |
| SMILES | CCCCOc1c(F)c(F)c(C#Cc2ccc(C#Cc3ccc(O)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C26H18F4O2/c1-2-3-16-32-26-24(29)22(27)21(23(28)25(26)30)15-12-18-7-4-17(5-8-18)6-9-19-10-13-20(31)14-11-19/h4-5,7-8,10-11,13-14,31H,2-3,16H2,1H3 |
| InChIKey | XJYMIGUHOFNPOL-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|