C34H38F4N2O2 — CID 101091223
(4-octoxyphenyl)-[4-[2-(2,3,5,6-tetrafluoro-4-hexoxyphenyl)ethynyl]phenyl]diazene (PubChem CID 101091223) has the molecular formula C34H38F4N2O2 and a molecular weight of 582.68 g/mol. Its IUPAC name is (4-octoxyphenyl)-[4-[2-(2,3,5,6-tetrafluoro-4-hexoxyphenyl)ethynyl]phenyl]diazene.
| Compound Name | (4-octoxyphenyl)-[4-[2-(2,3,5,6-tetrafluoro-4-hexoxyphenyl)ethynyl]phenyl]diazene |
|---|---|
| PubChem CID | 101091223 |
| Molecular Formula | C34H38F4N2O2 |
| Molecular Weight | 582.68 g/mol |
| Exact Mass | 582.29 |
| IUPAC Name | (4-octoxyphenyl)-[4-[2-(2,3,5,6-tetrafluoro-4-hexoxyphenyl)ethynyl]phenyl]diazene |
| SMILES | CCCCCCCCOc1ccc(/N=N/c2ccc(C#Cc3c(F)c(F)c(OCCCCCC)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C34H38F4N2O2/c1-3-5-7-9-10-12-23-41-28-20-18-27(19-21-28)40-39-26-16-13-25(14-17-26)15-22-29-30(35)32(37)34(33(38)31(29)36)42-24-11-8-6-4-2/h13-14,16-21H,3-12,23-24H2,1-2H3/b40-39+ |
| InChIKey | WMWIKIUWVIMXAN-XQQUEIPISA-N |
| XLogP | 10.76 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.68 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|