C16H13F5N2O — CID 134880151
(4-butoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)diazene (PubChem CID 134880151) has the molecular formula C16H13F5N2O and a molecular weight of 344.28 g/mol. Its IUPAC name is (4-butoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)diazene.
| Compound Name | (4-butoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)diazene |
|---|---|
| PubChem CID | 134880151 |
| Molecular Formula | C16H13F5N2O |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | (4-butoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)diazene |
| SMILES | CCCCOc1ccc(/N=N/c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C16H13F5N2O/c1-2-3-8-24-10-6-4-9(5-7-10)22-23-16-14(20)12(18)11(17)13(19)15(16)21/h4-7H,2-3,8H2,1H3/b23-22+ |
| InChIKey | XXGUCZSVRIXJQL-GHVJWSGMSA-N |
| XLogP | 5.98 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|