C31H34F2N2O2 — CID 101091271
(4-butoxyphenyl)-[4-[2-(2,3-difluoro-4-heptoxyphenyl)ethynyl]phenyl]diazene (PubChem CID 101091271) has the molecular formula C31H34F2N2O2 and a molecular weight of 504.62 g/mol. Its IUPAC name is (4-butoxyphenyl)-[4-[2-(2,3-difluoro-4-heptoxyphenyl)ethynyl]phenyl]diazene.
| Compound Name | (4-butoxyphenyl)-[4-[2-(2,3-difluoro-4-heptoxyphenyl)ethynyl]phenyl]diazene |
|---|---|
| PubChem CID | 101091271 |
| Molecular Formula | C31H34F2N2O2 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | (4-butoxyphenyl)-[4-[2-(2,3-difluoro-4-heptoxyphenyl)ethynyl]phenyl]diazene |
| SMILES | CCCCCCCOc1ccc(C#Cc2ccc(/N=N/c3ccc(OCCCC)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C31H34F2N2O2/c1-3-5-7-8-9-23-37-29-21-14-25(30(32)31(29)33)13-10-24-11-15-26(16-12-24)34-35-27-17-19-28(20-18-27)36-22-6-4-2/h11-12,14-21H,3-9,22-23H2,1-2H3/b35-34+ |
| InChIKey | UXPDYXHRMWNRDY-XAHDOWKMSA-N |
| XLogP | 9.31 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|