C22H20F2O3 — CID 163208164
2-[2,3-difluoro-4-[2-(4-pentoxyphenyl)ethynyl]phenyl]-1,3-dioxole (PubChem CID 163208164) has the molecular formula C22H20F2O3 and a molecular weight of 370.40 g/mol. Its IUPAC name is 2-[2,3-difluoro-4-[2-(4-pentoxyphenyl)ethynyl]phenyl]-1,3-dioxole.
| Compound Name | 2-[2,3-difluoro-4-[2-(4-pentoxyphenyl)ethynyl]phenyl]-1,3-dioxole |
|---|---|
| PubChem CID | 163208164 |
| Molecular Formula | C22H20F2O3 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-[2,3-difluoro-4-[2-(4-pentoxyphenyl)ethynyl]phenyl]-1,3-dioxole |
| SMILES | CCCCCOc1ccc(C#Cc2ccc(C3OC=CO3)c(F)c2F)cc1 |
| InChI | InChI=1S/C22H20F2O3/c1-2-3-4-13-25-18-10-6-16(7-11-18)5-8-17-9-12-19(21(24)20(17)23)22-26-14-15-27-22/h6-7,9-12,14-15,22H,2-4,13H2,1H3 |
| InChIKey | CZYUSYHDSRAAKH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|