C29H32F4O3 — CID 100951426
[4-[2-(2,3,5,6-tetrafluoro-4-pentoxyphenyl)ethynyl]phenyl] 4-propylcyclohexane-1-carboxylate (PubChem CID 100951426) has the molecular formula C29H32F4O3 and a molecular weight of 504.56 g/mol. Its IUPAC name is [4-[2-(2,3,5,6-tetrafluoro-4-pentoxyphenyl)ethynyl]phenyl] 4-propylcyclohexane-1-carboxylate.
| Compound Name | [4-[2-(2,3,5,6-tetrafluoro-4-pentoxyphenyl)ethynyl]phenyl] 4-propylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 100951426 |
| Molecular Formula | C29H32F4O3 |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | [4-[2-(2,3,5,6-tetrafluoro-4-pentoxyphenyl)ethynyl]phenyl] 4-propylcyclohexane-1-carboxylate |
| SMILES | CCCCCOc1c(F)c(F)c(C#Cc2ccc(OC(=O)C3CCC(CCC)CC3)cc2)c(F)c1F |
| InChI | InChI=1S/C29H32F4O3/c1-3-5-6-18-35-28-26(32)24(30)23(25(31)27(28)33)17-12-20-10-15-22(16-11-20)36-29(34)21-13-8-19(7-4-2)9-14-21/h10-11,15-16,19,21H,3-9,13-14,18H2,1-2H3 |
| InChIKey | VYYCTYBWUKPQHU-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|