C30H34F8O3 — CID 57162710
[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-pentoxyphenyl)phenyl] 4-hexylcyclohexane-1-carboxylate (PubChem CID 57162710) has the molecular formula C30H34F8O3 and a molecular weight of 594.58 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-pentoxyphenyl)phenyl] 4-hexylcyclohexane-1-carboxylate.
| Compound Name | [2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-pentoxyphenyl)phenyl] 4-hexylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 57162710 |
| Molecular Formula | C30H34F8O3 |
| Molecular Weight | 594.58 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-pentoxyphenyl)phenyl] 4-hexylcyclohexane-1-carboxylate |
| SMILES | CCCCCCC1CCC(C(=O)Oc2c(F)c(F)c(-c3c(F)c(F)c(OCCCCC)c(F)c3F)c(F)c2F)CC1 |
| InChI | InChI=1S/C30H34F8O3/c1-3-5-7-8-10-16-11-13-17(14-12-16)30(39)41-29-26(37)22(33)19(23(34)27(29)38)18-20(31)24(35)28(25(36)21(18)32)40-15-9-6-4-2/h16-17H,3-15H2,1-2H3 |
| InChIKey | ZAPNMFBYTZEMDY-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.58 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|