C32H40F8O — CID 102586148
1,2,4,5-tetrafluoro-3-heptoxy-6-[2,3,5,6-tetrafluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]benzene (PubChem CID 102586148) has the molecular formula C32H40F8O and a molecular weight of 592.66 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-heptoxy-6-[2,3,5,6-tetrafluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-heptoxy-6-[2,3,5,6-tetrafluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]benzene |
|---|---|
| PubChem CID | 102586148 |
| Molecular Formula | C32H40F8O |
| Molecular Weight | 592.66 g/mol |
| Exact Mass | 592.30 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-heptoxy-6-[2,3,5,6-tetrafluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]benzene |
| SMILES | CCCCCCCOc1c(F)c(F)c(-c2c(F)c(F)c(CCC3CCC(CCCCC)CC3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C32H40F8O/c1-3-5-7-8-10-18-41-32-30(39)28(37)23(29(38)31(32)40)22-26(35)24(33)21(25(34)27(22)36)17-16-20-14-12-19(13-15-20)11-9-6-4-2/h19-20H,3-18H2,1-2H3 |
| InChIKey | YZUJNPGZFGWVLQ-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.66 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|