C35H46F8O — CID 102586151
1-decoxy-2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]benzene (PubChem CID 102586151) has the molecular formula C35H46F8O and a molecular weight of 634.74 g/mol. Its IUPAC name is 1-decoxy-2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]benzene.
| Compound Name | 1-decoxy-2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]benzene |
|---|---|
| PubChem CID | 102586151 |
| Molecular Formula | C35H46F8O |
| Molecular Weight | 634.74 g/mol |
| Exact Mass | 634.34 |
| IUPAC Name | 1-decoxy-2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]benzene |
| SMILES | CCCCCCCCCCOc1c(F)c(F)c(-c2c(F)c(F)c(CCC3CCC(CCCCC)CC3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C35H46F8O/c1-3-5-7-8-9-10-11-13-21-44-35-33(42)31(40)26(32(41)34(35)43)25-29(38)27(36)24(28(37)30(25)39)20-19-23-17-15-22(16-18-23)14-12-6-4-2/h22-23H,3-21H2,1-2H3 |
| InChIKey | HVNJFGJQWRCUFE-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.74 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|