C37H40N4O2+2 — CID 170133299
[(Z)-2-(dimethylamino)ethenyl]-methylidene-[3-[4-[2-[4-[2-[4-[3-(3-methylimidazol-3-ium-1-yl)propoxy]phenyl]ethynyl]phenyl]ethynyl]phenoxy]propyl]azanium (PubChem CID 170133299) has the molecular formula C37H40N4O2+2 and a molecular weight of 572.75 g/mol. Its IUPAC name is [(Z)-2-(dimethylamino)ethenyl]-methylidene-[3-[4-[2-[4-[2-[4-[3-(3-methylimidazol-3-ium-1-yl)propoxy]phenyl]ethynyl]phenyl]ethynyl]phenoxy]propyl]azanium.
| Compound Name | [(Z)-2-(dimethylamino)ethenyl]-methylidene-[3-[4-[2-[4-[2-[4-[3-(3-methylimidazol-3-ium-1-yl)propoxy]phenyl]ethynyl]phenyl]ethynyl]phenoxy]propyl]azanium |
|---|---|
| PubChem CID | 170133299 |
| Molecular Formula | C37H40N4O2+2 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | [(Z)-2-(dimethylamino)ethenyl]-methylidene-[3-[4-[2-[4-[2-[4-[3-(3-methylimidazol-3-ium-1-yl)propoxy]phenyl]ethynyl]phenyl]ethynyl]phenoxy]propyl]azanium |
| SMILES | C=[N+](/C=C\N(C)C)CCCOc1ccc(C#Cc2ccc(C#Cc3ccc(OCCCn4cc[n+](C)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H40N4O2/c1-38(2)25-26-39(3)23-5-29-42-36-19-15-34(16-20-36)13-11-32-7-9-33(10-8-32)12-14-35-17-21-37(22-18-35)43-30-6-24-41-28-27-40(4)31-41/h7-10,15-22,25-28,31H,3,5-6,23-24,29-30H2,1-2,4H3/q+2/b26-25- |
| InChIKey | YOGHFYSXMGOSNV-QPLCGJKRSA-N |
| XLogP | 5.10 |
| TPSA | 33.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|