C24H32N4O2+2 — CID 122452430
1-methyl-3-[3-[2-methyl-4-[3-(3-methylimidazol-3-ium-1-yl)propoxy]-5-prop-1-ynylphenoxy]propyl]imidazol-1-ium (PubChem CID 122452430) has the molecular formula C24H32N4O2+2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 1-methyl-3-[3-[2-methyl-4-[3-(3-methylimidazol-3-ium-1-yl)propoxy]-5-prop-1-ynylphenoxy]propyl]imidazol-1-ium.
| Compound Name | 1-methyl-3-[3-[2-methyl-4-[3-(3-methylimidazol-3-ium-1-yl)propoxy]-5-prop-1-ynylphenoxy]propyl]imidazol-1-ium |
|---|---|
| PubChem CID | 122452430 |
| Molecular Formula | C24H32N4O2+2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 1-methyl-3-[3-[2-methyl-4-[3-(3-methylimidazol-3-ium-1-yl)propoxy]-5-prop-1-ynylphenoxy]propyl]imidazol-1-ium |
| SMILES | CC#Cc1cc(OCCCn2cc[n+](C)c2)c(C)cc1OCCCn1cc[n+](C)c1 |
| InChI | InChI=1S/C24H32N4O2/c1-5-8-22-18-23(29-15-6-9-27-13-11-25(3)19-27)21(2)17-24(22)30-16-7-10-28-14-12-26(4)20-28/h11-14,17-20H,6-7,9-10,15-16H2,1-4H3/q+2 |
| InChIKey | BHZJGSXWHFHZTB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 36.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|