C41H62NO10+ — CID 159360088
[2-[2-[2,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-4-prop-1-ynylphenyl]ethynyl]-4-ethoxy-5-methylphenoxy]methyl-triethylazanium (PubChem CID 159360088) has the molecular formula C41H62NO10+ and a molecular weight of 728.94 g/mol. Its IUPAC name is [2-[2-[2,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-4-prop-1-ynylphenyl]ethynyl]-4-ethoxy-5-methylphenoxy]methyl-triethylazanium.
| Compound Name | [2-[2-[2,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-4-prop-1-ynylphenyl]ethynyl]-4-ethoxy-5-methylphenoxy]methyl-triethylazanium |
|---|---|
| PubChem CID | 159360088 |
| Molecular Formula | C41H62NO10+ |
| Molecular Weight | 728.94 g/mol |
| Exact Mass | 728.44 |
| IUPAC Name | [2-[2-[2,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-4-prop-1-ynylphenyl]ethynyl]-4-ethoxy-5-methylphenoxy]methyl-triethylazanium |
| SMILES | CC#Cc1cc(OCCOCCOCCOC)c(C#Cc2cc(OCC)c(C)cc2OC[N+](CC)(CC)CC)cc1OCCOCCOCCOC |
| InChI | InChI=1S/C41H62NO10/c1-9-14-35-31-41(51-28-26-48-24-22-46-20-18-44-8)37(32-40(35)50-27-25-47-23-21-45-19-17-43-7)16-15-36-30-38(49-13-5)34(6)29-39(36)52-33-42(10-2,11-3)12-4/h29-32H,10-13,17-28,33H2,1-8H3/q+1 |
| InChIKey | LKTCAAIGOKOAEI-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.94 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|