C30H50O8Si2 — CID 11135721
2-[4,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane (PubChem CID 11135721) has the molecular formula C30H50O8Si2 and a molecular weight of 594.89 g/mol. Its IUPAC name is 2-[4,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[4,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 11135721 |
| Molecular Formula | C30H50O8Si2 |
| Molecular Weight | 594.89 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | 2-[4,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-(2-trimethylsilylethynyl)phenyl]ethynyl-trimethylsilane |
| SMILES | COCCOCCOCCOc1cc(C#C[Si](C)(C)C)c(C#C[Si](C)(C)C)cc1OCCOCCOCCOC |
| InChI | InChI=1S/C30H50O8Si2/c1-31-11-13-33-15-17-35-19-21-37-29-25-27(9-23-39(3,4)5)28(10-24-40(6,7)8)26-30(29)38-22-20-36-18-16-34-14-12-32-2/h25-26H,11-22H2,1-8H3 |
| InChIKey | VFGWVPUQBZGLEU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.89 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|