C35H46O10Si — CID 102463340
2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-[2-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxycarbonyl]phenyl]ethynyl]-5-(2-trimethylsilylethynyl)benzoate (PubChem CID 102463340) has the molecular formula C35H46O10Si and a molecular weight of 654.83 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-[2-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxycarbonyl]phenyl]ethynyl]-5-(2-trimethylsilylethynyl)benzoate.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-[2-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxycarbonyl]phenyl]ethynyl]-5-(2-trimethylsilylethynyl)benzoate |
|---|---|
| PubChem CID | 102463340 |
| Molecular Formula | C35H46O10Si |
| Molecular Weight | 654.83 g/mol |
| Exact Mass | 654.29 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-[2-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxycarbonyl]phenyl]ethynyl]-5-(2-trimethylsilylethynyl)benzoate |
| SMILES | COCCOCCOCCOC(=O)c1cccc(C#Cc2cc(C#C[Si](C)(C)C)cc(C(=O)OCCOCCOCCOC)c2)c1 |
| InChI | InChI=1S/C35H46O10Si/c1-38-12-14-40-16-18-42-20-22-44-34(36)32-8-6-7-29(26-32)9-10-30-25-31(11-24-46(3,4)5)28-33(27-30)35(37)45-23-21-43-19-17-41-15-13-39-2/h6-8,25-28H,12-23H2,1-5H3 |
| InChIKey | XXTJWSIFCIYBSL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.83 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|