C30H48O5Si2 — CID 11628096
2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-(2-trimethylsilylethynyl)-5-[2-tri(propan-2-yl)silylethynyl]benzoate (PubChem CID 11628096) has the molecular formula C30H48O5Si2 and a molecular weight of 544.88 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-(2-trimethylsilylethynyl)-5-[2-tri(propan-2-yl)silylethynyl]benzoate.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-(2-trimethylsilylethynyl)-5-[2-tri(propan-2-yl)silylethynyl]benzoate |
|---|---|
| PubChem CID | 11628096 |
| Molecular Formula | C30H48O5Si2 |
| Molecular Weight | 544.88 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-(2-trimethylsilylethynyl)-5-[2-tri(propan-2-yl)silylethynyl]benzoate |
| SMILES | COCCOCCOCCOC(=O)c1cc(C#C[Si](C)(C)C)cc(C#C[Si](C(C)C)(C(C)C)C(C)C)c1 |
| InChI | InChI=1S/C30H48O5Si2/c1-24(2)37(25(3)4,26(5)6)20-12-28-21-27(11-19-36(8,9)10)22-29(23-28)30(31)35-18-17-34-16-15-33-14-13-32-7/h21-26H,13-18H2,1-10H3 |
| InChIKey | IVJHABNEIIWJBX-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.88 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|